ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 50636-02-7 5-chloro-6-methyl-2,1,3-benzothiadiazole | |
| termék neve | 5-chloro-6-methyl-2,1,3-benzothiadiazole | 
| Angol név | 5-chloro-6-methyl-2,1,3-benzothiadiazole; | 
| MF | C7H5ClN2S | 
| Molekulatömeg | 184.646 | 
| InChI | InChI=1/C7H5ClN2S/c1-4-2-6-7(3-5(4)8)10-11-9-6/h2-3H,1H3 | 
| CAS-szám | 50636-02-7 | 
| Molekuláris szerkezete |  | 
| Sűrűség | 1.445g/cm3 | 
| Olvadáspont | 85℃ | 
| Forráspont | 266.9°C at 760 mmHg | 
| Törésmutató | 1.682 | 
| Gyulladáspont | 115.2°C | 
| Gőznyomás | 0.0138mmHg at 25°C | 
| Veszély szimbólumok | |
| Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; | 
| MSDS | |