ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 50636-02-7 5-chloro-6-methyl-2,1,3-benzothiadiazole | |
| Nama produk | 5-chloro-6-methyl-2,1,3-benzothiadiazole | 
| Nama Inggeris | 5-chloro-6-methyl-2,1,3-benzothiadiazole; | 
| MF | C7H5ClN2S | 
| Berat Molekul | 184.646 | 
| InChI | InChI=1/C7H5ClN2S/c1-4-2-6-7(3-5(4)8)10-11-9-6/h2-3H,1H3 | 
| CAS NO | 50636-02-7 | 
| Struktur Molekul |  | 
| Kepadatan | 1.445g/cm3 | 
| Titik lebur | 85℃ | 
| Titik didih | 266.9°C at 760 mmHg | 
| Indeks bias | 1.682 | 
| Titik nyala | 115.2°C | 
| Tekanan wap | 0.0138mmHg at 25°C | 
| Cinta bahaya | |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; | 
| MSDS | |