ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51660-08-3 5-klór-6-fenilpiridazin-3-ol |
|
| termék neve | 5-klór-6-fenilpiridazin-3-ol |
| Szinonimák | 5-klór-2-metil-6-fenilpiridazin-3(2H)-on; 5-klór-6-fenilpiridazin-3(2H)-on; |
| Angol név | 5-chloro-6-phenylpyridazin-3-ol;5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one;5-chloro-6-phenylpyridazin-3(2H)-one |
| MF | C10H7ClN2O |
| Molekulatömeg | 206.6284 |
| InChI | InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
| CAS-szám | 51660-08-3 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.35g/cm3 |
| Olvadáspont | 235℃ |
| Forráspont | 403.2°C at 760 mmHg |
| Törésmutató | 1.641 |
| Gyulladáspont | 197.7°C |
| Gőznyomás | 4.44E-07mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |