ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51660-08-3 5-클로로-6-페닐피리다진-3-올 |
|
| 상품명칭 | 5-클로로-6-페닐피리다진-3-올 |
| 별명 | 5-클로로-2-메틸-6-페닐피리다진-3(2H)-온; 5-클로로-6-페닐피리다진-3(2H)-온; |
| 영문 이름 | 5-chloro-6-phenylpyridazin-3-ol;5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one;5-chloro-6-phenylpyridazin-3(2H)-one |
| 분자식 | C10H7ClN2O |
| 분자량 | 206.6284 |
| InChI | InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
| cas번호 | 51660-08-3 |
| 분자 구조 | ![]() |
| 밀도 | 1.35g/cm3 |
| 녹는 점 | 235℃ |
| 비등점 | 403.2°C at 760 mmHg |
| 굴절 지수 | 1.641 |
| 인화점 | 197.7°C |
| 증기압 | 4.44E-07mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |