ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
556-48-9 1,4-Cyclohexanediol, mixture of cis and trans |
|
termék neve | 1,4-Cyclohexanediol, mixture of cis and trans |
Angol név | 1,4-Cyclohexanediol, mixture of cis and trans;Cyclohexanediolcistrans;1,4-Cyclohexanediol;Hexahydrohydroquinone;1,4-Hexandiol;Quinitol;1,4-Bis(hydroxymethyl)-cyclohexane;cyclohexane-1,4-diol;trans-cyclohexane-1,4-diol;1,4-Cyclohexanediol (cis & trans mixture) |
MF | C6H12O2 |
Molekulatömeg | 116.1583 |
InChI | InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
CAS-szám | 556-48-9 |
EINECS | 209-126-2 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.156g/cm3 |
Olvadáspont | 98-100℃ |
Forráspont | 252.4°C at 760 mmHg |
Törésmutató | 1.526 |
Gyulladáspont | 65.6°C |
Gőznyomás | 0.00301mmHg at 25°C |
Biztonsági Leírás | S24/25:; |
MSDS |