ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
556-48-9 1,4-Cyclohexanediol, mixture of cis and trans |
|
produktnavn | 1,4-Cyclohexanediol, mixture of cis and trans |
Engelsk navn | 1,4-Cyclohexanediol, mixture of cis and trans;Cyclohexanediolcistrans;1,4-Cyclohexanediol;Hexahydrohydroquinone;1,4-Hexandiol;Quinitol;1,4-Bis(hydroxymethyl)-cyclohexane;cyclohexane-1,4-diol;trans-cyclohexane-1,4-diol;1,4-Cyclohexanediol (cis & trans mixture) |
Molekylær Formel | C6H12O2 |
Molekylvekt | 116.1583 |
InChI | InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
CAS-nummer | 556-48-9 |
EINECS | 209-126-2 |
Molecular Structure | ![]() |
Tetthet | 1.156g/cm3 |
Smeltepunkt | 98-100℃ |
Kokepunkt | 252.4°C at 760 mmHg |
Brytningsindeks | 1.526 |
Flammepunktet | 65.6°C |
Damptrykk | 0.00301mmHg at 25°C |
Sikkerhet Beskrivelse | S24/25:; |
MSDS |