ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-27-3 ethyl 2-ethoxy-2-iminoacetate |
|
| termék neve | ethyl 2-ethoxy-2-iminoacetate |
| Angol név | ethyl 2-ethoxy-2-iminoacetate;ethyl carboethoxyformimidate;ethyl carbethoxyformimidate;ethyl 2-imino-2-ethoxyacetate;Oxalomonoimidic acid diethyl ester;ethyl ethoxyiminoacetate;ethoxy-imino-acetic acid ethyl ester;ETHYL 2-ETHOXY-2-IMINOACETATE |
| MF | C6H11NO3 |
| Molekulatömeg | 145.1564 |
| InChI | InChI=1/C6H11NO3/c1-3-9-5(7)6(8)10-4-2/h7H,3-4H2,1-2H3 |
| CAS-szám | 816-27-3 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.081g/cm3 |
| Forráspont | 151.068°C at 760 mmHg |
| Törésmutató | 1.44 |
| Gyulladáspont | 45.165°C |
| Gőznyomás | 3.729mmHg at 25°C |
| MSDS | |