ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-27-3 ethyl 2-ethoxy-2-iminoacetate |
|
| Ürün Adı | ethyl 2-ethoxy-2-iminoacetate |
| ingilizce adı | ethyl 2-ethoxy-2-iminoacetate;ethyl carboethoxyformimidate;ethyl carbethoxyformimidate;ethyl 2-imino-2-ethoxyacetate;Oxalomonoimidic acid diethyl ester;ethyl ethoxyiminoacetate;ethoxy-imino-acetic acid ethyl ester;ETHYL 2-ETHOXY-2-IMINOACETATE |
| Moleküler Formülü | C6H11NO3 |
| Molekül Ağırlığı | 145.1564 |
| InChI | InChI=1/C6H11NO3/c1-3-9-5(7)6(8)10-4-2/h7H,3-4H2,1-2H3 |
| CAS kayıt numarası | 816-27-3 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.081g/cm3 |
| Kaynama noktası | 151.068°C at 760 mmHg |
| Kırılma indisi | 1.44 |
| Alevlenme noktası | 45.165°C |
| Buhar basıncı | 3.729mmHg at 25°C |
| MSDS | |