ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
817-09-4 Tris(2-chloroethyl)amine hydrochloride |
|
| termék neve | Tris(2-chloroethyl)amine hydrochloride |
| Angol név | Tris(2-chloroethyl)amine hydrochloride;2,2,2-Trichlorotriethylamine hydrochloride;2-chloro-N,N-bis(2-chloroethyl)ethanaminium;Tris-(2-chloroethyl)amine hydrochloride |
| MF | C6H13Cl3N |
| Molekulatömeg | 205.5326 |
| InChI | InChI=1/C6H12Cl3N/c7-1-4-10(5-2-8)6-3-9/h1-6H2/p+1 |
| CAS-szám | 817-09-4 |
| EINECS | 212-442-3 |
| Molekuláris szerkezete | ![]() |
| Olvadáspont | 127-132℃ |
| Forráspont | 156.2°C at 760 mmHg |
| Gyulladáspont | 48.3°C |
| Gőznyomás | 2.92mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R26/27/28##Very toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.||R40##Possible risks of irreversible effects.:; |
| Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |