ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
817-09-4 Tris(2-chloroethyl)amine hydrochloride |
|
| 상품명칭 | Tris(2-chloroethyl)amine hydrochloride |
| 영문 이름 | Tris(2-chloroethyl)amine hydrochloride;2,2,2-Trichlorotriethylamine hydrochloride;2-chloro-N,N-bis(2-chloroethyl)ethanaminium;Tris-(2-chloroethyl)amine hydrochloride |
| 분자식 | C6H13Cl3N |
| 분자량 | 205.5326 |
| InChI | InChI=1/C6H12Cl3N/c7-1-4-10(5-2-8)6-3-9/h1-6H2/p+1 |
| cas번호 | 817-09-4 |
| EC번호 | 212-442-3 |
| 분자 구조 | ![]() |
| 녹는 점 | 127-132℃ |
| 비등점 | 156.2°C at 760 mmHg |
| 인화점 | 48.3°C |
| 증기압 | 2.92mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R26/27/28##Very toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.||R40##Possible risks of irreversible effects.:; |
| 보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |