ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-78-6 cyclohexylacetone |
|
| Nama produk | cyclohexylacetone |
| Nama bahasa Inggris | cyclohexylacetone;Cyclohexylacetone, (Acetonylcyclohexane);Acetonylcyclohexane;Cyclohexyacetone;1-cyclohexylpropan-2-one;1-cyclohexylacetone |
| MF | C9H16O |
| Berat Molekul | 140.2227 |
| InChI | InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
| CAS NO | 103-78-6 |
| EINECS | 203-143-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.889g/cm3 |
| Titik didih | 188.1°C at 760 mmHg |
| Indeks bias | 1.441 |
| Titik nyala | 65.3°C |
| Tekanan uap | 0.609mmHg at 25°C |
| Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |