ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-78-6 cyclohexylacetone |
|
| Ürün Adı | cyclohexylacetone |
| ingilizce adı | cyclohexylacetone;Cyclohexylacetone, (Acetonylcyclohexane);Acetonylcyclohexane;Cyclohexyacetone;1-cyclohexylpropan-2-one;1-cyclohexylacetone |
| Moleküler Formülü | C9H16O |
| Molekül Ağırlığı | 140.2227 |
| InChI | InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
| CAS kayıt numarası | 103-78-6 |
| EINECS | 203-143-9 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 0.889g/cm3 |
| Kaynama noktası | 188.1°C at 760 mmHg |
| Kırılma indisi | 1.441 |
| Alevlenme noktası | 65.3°C |
| Buhar basıncı | 0.609mmHg at 25°C |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |