ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22921-68-2 2-Bromo-5-methoxybenzoic acid |
|
Nama produk | 2-Bromo-5-methoxybenzoic acid |
Nama bahasa Inggris | 2-Bromo-5-methoxybenzoic acid;6-Bromo-m-anisic acid;2-bromo-5-methoxybenzoate |
MF | C8H6BrO3 |
Berat Molekul | 230.036 |
InChI | InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
CAS NO | 22921-68-2 |
EINECS | 245-329-2 |
Struktur Molekul | ![]() |
Titik lebur | 158-159℃ |
Titik didih | 337.8°C at 760 mmHg |
Titik nyala | 158.1°C |
Tekanan uap | 4E-05mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |