ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22921-68-2 2-Bromo-5-methoxybenzoic acid |
|
상품명칭 | 2-Bromo-5-methoxybenzoic acid |
영문 이름 | 2-Bromo-5-methoxybenzoic acid;6-Bromo-m-anisic acid;2-bromo-5-methoxybenzoate |
분자식 | C8H6BrO3 |
분자량 | 230.036 |
InChI | InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
cas번호 | 22921-68-2 |
EC번호 | 245-329-2 |
분자 구조 | ![]() |
녹는 점 | 158-159℃ |
비등점 | 337.8°C at 760 mmHg |
인화점 | 158.1°C |
증기압 | 4E-05mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |