ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
275-51-4 Azulene |
|
| Nama produk | Azulene |
| Nama bahasa Inggris | Azulene;Bicyclo[5.3.0]decapentaene;Azunamic;Cyclopentacycloheptene;Bicyclo(5.3.0)-deca-2,4,6,8,10-pentaene;Bicyclo(5.3.0)-1,3,5,7,9-decapentaene;EINECS |
| MF | C10H8 |
| Berat Molekul | 128.1705 |
| InChI | InChI=1/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
| CAS NO | 275-51-4 |
| EINECS | 205-993-6 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.037g/cm3 |
| Titik lebur | 99-101℃ |
| Titik didih | 220.7°C at 760 mmHg |
| Indeks bias | 1.632 |
| Titik nyala | 76.7°C |
| Tekanan uap | 0.165mmHg at 25°C |
| Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |