ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
275-51-4 Azulene |
|
| produktnavn | Azulene |
| Engelsk navn | Azulene;Bicyclo[5.3.0]decapentaene;Azunamic;Cyclopentacycloheptene;Bicyclo(5.3.0)-deca-2,4,6,8,10-pentaene;Bicyclo(5.3.0)-1,3,5,7,9-decapentaene;EINECS |
| Molekylær Formel | C10H8 |
| Molekylvekt | 128.1705 |
| InChI | InChI=1/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
| CAS-nummer | 275-51-4 |
| EINECS | 205-993-6 |
| Molecular Structure | ![]() |
| Tetthet | 1.037g/cm3 |
| Smeltepunkt | 99-101℃ |
| Kokepunkt | 220.7°C at 760 mmHg |
| Brytningsindeks | 1.632 |
| Flammepunktet | 76.7°C |
| Damptrykk | 0.165mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |