ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2935-63-9 2,3-Dimethylphenoxyacetic acid |
|
Nama produk | 2,3-Dimethylphenoxyacetic acid |
Nama bahasa Inggris | 2,3-Dimethylphenoxyacetic acid;2,3-Xylyloxyacetic acid;(2,3-dimethylphenoxy)acetate |
MF | C10H11O3 |
Berat Molekul | 179.1931 |
InChI | InChI=1/C10H12O3/c1-7-4-3-5-9(8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
CAS NO | 2935-63-9 |
EINECS | 220-911-9 |
Struktur Molekul | ![]() |
Titik didih | 315.2°C at 760 mmHg |
Titik nyala | 124.3°C |
Tekanan uap | 0.000187mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |