Chemindex > 2935-63-9
KR ▼
2935-63-9 2,3-Dimethylphenoxyacetic acid |
|
| 상품명칭 | 2,3-Dimethylphenoxyacetic acid |
| 영문 이름 | 2,3-Dimethylphenoxyacetic acid;2,3-Xylyloxyacetic acid;(2,3-dimethylphenoxy)acetate |
| 분자식 | C10H11O3 |
| 분자량 | 179.1931 |
| InChI | InChI=1/C10H12O3/c1-7-4-3-5-9(8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
| cas번호 | 2935-63-9 |
| EC번호 | 220-911-9 |
| 분자 구조 |  |
| 비등점 | 315.2°C at 760 mmHg |
| 인화점 | 124.3°C |
| 증기압 | 0.000187mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 