ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332163-07-2 4,5-dimethoxy-2- [(thiophen-2-ylacetyl) amino]benzoate |
|
| Nama produk | 4,5-dimethoxy-2- [(thiophen-2-ylacetyl) amino]benzoate |
| Sinonim | ; |
| Nama bahasa Inggris | 4,5-dimethoxy-2-[(thiophen-2-ylacetyl)amino]benzoate; |
| MF | C15H14NO5S |
| Berat Molekul | 320.3409 |
| InChI | InChI=1/C15H15NO5S/c1-20-12-7-10(15(18)19)11(8-13(12)21-2)16-14(17)6-9-4-3-5-22-9/h3-5,7-8H,6H2,1-2H3,(H,16,17)(H,18,19)/p-1 |
| CAS NO | 332163-07-2 |
| Struktur Molekul | ![]() |
| Titik didih | 549.8°C at 760 mmHg |
| Titik nyala | 286.3°C |
| Tekanan uap | 6.4E-13mmHg at 25°C |
| MSDS | |