ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332163-07-2 4,5-dimethoxy-2-[(thiofeen-2-ylacetyl)amino]benzoaat |
|
| Naam product | 4,5-dimethoxy-2-[(thiofeen-2-ylacetyl)amino]benzoaat |
| Engelse naam | 4,5-dimethoxy-2-[(thiophen-2-ylacetyl)amino]benzoate; |
| MF | C15H14NO5S |
| Molecuulgewicht | 320.3409 |
| InChI | InChI=1/C15H15NO5S/c1-20-12-7-10(15(18)19)11(8-13(12)21-2)16-14(17)6-9-4-3-5-22-9/h3-5,7-8H,6H2,1-2H3,(H,16,17)(H,18,19)/p-1 |
| CAS-nummer | 332163-07-2 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 549.8°C at 760 mmHg |
| Vlampunt | 286.3°C |
| Dampdruk | 6.4E-13mmHg at 25°C |
| MSDS | |