ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332927-03-4 Acridine-9-carboxylic acid hydrate |
|
| Nama produk | Acridine-9-carboxylic acid hydrate |
| Nama bahasa Inggris | Acridine-9-carboxylic acid hydrate;acridine-9-carboxylic acid;acridine-9-carboxylate |
| MF | C14H9NO2 |
| Berat Molekul | 222.2194 |
| InChI | InChI=1/C14H9NO2/c16-14(17)13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17)/p-1 |
| CAS NO | 332927-03-4 |
| Struktur Molekul | ![]() |
| Titik lebur | 290℃ |
| Titik didih | 480.4°C at 760 mmHg |
| Titik nyala | 244.3°C |
| Tekanan uap | 4.88E-10mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |