ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332927-03-4 Acridine-9-carboxylic acid hydrate |
|
| 상품명칭 | Acridine-9-carboxylic acid hydrate |
| 영문 이름 | Acridine-9-carboxylic acid hydrate;acridine-9-carboxylic acid;acridine-9-carboxylate |
| 분자식 | C14H9NO2 |
| 분자량 | 222.2194 |
| InChI | InChI=1/C14H9NO2/c16-14(17)13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17)/p-1 |
| cas번호 | 332927-03-4 |
| 분자 구조 | ![]() |
| 녹는 점 | 290℃ |
| 비등점 | 480.4°C at 760 mmHg |
| 인화점 | 244.3°C |
| 증기압 | 4.88E-10mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |