ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
342411-14-7 2,1,3-benzothiadiazol-4-yl isocyanate |
|
Nama produk | 2,1,3-benzothiadiazol-4-yl isocyanate |
Nama bahasa Inggris | 2,1,3-benzothiadiazol-4-yl isocyanate;4-isocyanato-2,1,3-benzothiadiazole |
MF | C7H3N3OS |
Berat Molekul | 177.1832 |
InChI | InChI=1/C7H3N3OS/c11-4-8-5-2-1-3-6-7(5)10-12-9-6/h1-3H |
CAS NO | 342411-14-7 |
Struktur Molekul | ![]() |
Kepadatan | 1.55g/cm3 |
Titik lebur | 77℃ |
Titik didih | 268.1°C at 760 mmHg |
Indeks bias | 1.772 |
Titik nyala | 115.9°C |
Tekanan uap | 0.00786mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |