ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
342411-14-7 2,1,3-benzothiadiazol-4-yl isocyanate |
|
Nazwa produktu: | 2,1,3-benzothiadiazol-4-yl isocyanate |
Angielska nazwa | 2,1,3-benzothiadiazol-4-yl isocyanate;4-isocyanato-2,1,3-benzothiadiazole |
MF | C7H3N3OS |
Masie cząsteczkowej | 177.1832 |
InChI | InChI=1/C7H3N3OS/c11-4-8-5-2-1-3-6-7(5)10-12-9-6/h1-3H |
Nr CAS | 342411-14-7 |
Struktury molekularnej | ![]() |
Gęstość | 1.55g/cm3 |
Temperatura topnienia | 77℃ |
Temperatura wrzenia | 268.1°C at 760 mmHg |
Współczynnik załamania | 1.772 |
Temperatura zapłonu | 115.9°C |
Ciśnienie pary | 0.00786mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |