ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3491-63-2 2-Phenyl-2-pentenal |
|
Nama produk | 2-Phenyl-2-pentenal |
Nama bahasa Inggris | 2-Phenyl-2-pentenal;Benzeneacetaldehyde, alpha-propylidene-;(2E)-2-phenylpent-2-enal |
MF | C11H12O |
Berat Molekul | 160.2124 |
InChI | InChI=1/C11H12O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-9H,2H2,1H3/b11-6- |
CAS NO | 3491-63-2 |
Struktur Molekul | ![]() |
Kepadatan | 0.976g/cm3 |
Titik didih | 286.7°C at 760 mmHg |
Indeks bias | 1.524 |
Titik nyala | 106.2°C |
Tekanan uap | 0.0026mmHg at 25°C |
Kode Risiko | R36/38##Irritating to eyes and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |