ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3491-63-2 2-Phenyl-2-pentenal |
|
상품명칭 | 2-Phenyl-2-pentenal |
영문 이름 | 2-Phenyl-2-pentenal;Benzeneacetaldehyde, alpha-propylidene-;(2E)-2-phenylpent-2-enal |
분자식 | C11H12O |
분자량 | 160.2124 |
InChI | InChI=1/C11H12O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-9H,2H2,1H3/b11-6- |
cas번호 | 3491-63-2 |
분자 구조 | ![]() |
밀도 | 0.976g/cm3 |
비등점 | 286.7°C at 760 mmHg |
굴절 지수 | 1.524 |
인화점 | 106.2°C |
증기압 | 0.0026mmHg at 25°C |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |