Chemindex > 499771-13-0
ID ▼
499771-13-0 isopropil 2-[2-(4-klorofenil)-1,3-thiazol-4-yl]asetat |
|
| Nama produk | isopropil 2-[2-(4-klorofenil)-1,3-thiazol-4-yl]asetat |
| Sinonim | 1-metiletil [2- (4-klorofenil) -1,3-thiazol-4-yl] asetat; |
| Nama bahasa Inggris | isopropyl 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate;1-methylethyl [2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| MF | C14H14ClNO2S |
| Berat Molekul | 295.7845 |
| InChI | InChI=1/C14H14ClNO2S/c1-9(2)18-13(17)7-12-8-19-14(16-12)10-3-5-11(15)6-4-10/h3-6,8-9H,7H2,1-2H3 |
| CAS NO | 499771-13-0 |
| Struktur Molekul | ![499771-13-0 isopropil 2-[2-(4-klorofenil)-1,3-thiazol-4-yl]asetat](https://images-a.chemnet.com/suppliers/chembase/163/16311.gif "499771-13-0 isopropil 2-[2-(4-klorofenil)-1,3-thiazol-4-yl]asetat") |
| Kepadatan | 1.255g/cm3 |
| Titik lebur | 82℃ |
| Titik didih | 406.7°C at 760 mmHg |
| Indeks bias | 1.57 |
| Titik nyala | 199.7°C |
| Tekanan uap | 8E-07mmHg at 25°C |
| Simbol bahaya |  Xi##Irritant:; |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 499771-13-0 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 