ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
499771-13-0 이소 프로필 2- [2- (4- 클로로 페닐) -1,3- 티아 졸 -4- 일] 아세테이트 |
|
상품명칭 | 이소 프로필 2- [2- (4- 클로로 페닐) -1,3- 티아 졸 -4- 일] 아세테이트 |
별명 | 1- 메틸 에틸 [2- (4- 클로로 페닐) -1,3- 티아 졸 -4- 일] 아세테이트; |
영문 이름 | isopropyl 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate;1-methylethyl [2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate |
분자식 | C14H14ClNO2S |
분자량 | 295.7845 |
InChI | InChI=1/C14H14ClNO2S/c1-9(2)18-13(17)7-12-8-19-14(16-12)10-3-5-11(15)6-4-10/h3-6,8-9H,7H2,1-2H3 |
cas번호 | 499771-13-0 |
분자 구조 | ![]() |
밀도 | 1.255g/cm3 |
녹는 점 | 82℃ |
비등점 | 406.7°C at 760 mmHg |
굴절 지수 | 1.57 |
인화점 | 199.7°C |
증기압 | 8E-07mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |