ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
|
| Nama produk | 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
| Nama bahasa Inggris | 2,3,6-trinitrophenol moistened with water (H2O ~40%); |
| MF | C6H3N3O7 |
| Berat Molekul | 229.1039 |
| InChI | InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
| CAS NO | 603-10-1 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.856g/cm3 |
| Titik lebur | 119-120℃ |
| Titik didih | 337.9°C at 760 mmHg |
| Indeks bias | 1.701 |
| Titik nyala | 151.1°C |
| Tekanan uap | 5.2E-05mmHg at 25°C |
| MSDS | |