ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
|
| Nome del prodotto | 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
| Nome inglese | 2,3,6-trinitrophenol moistened with water (H2O ~40%); |
| Formula molecolare | C6H3N3O7 |
| Peso Molecolare | 229.1039 |
| InChI | InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
| Numero CAS | 603-10-1 |
| Struttura molecolare | ![]() |
| Densità | 1.856g/cm3 |
| Punto di fusione | 119-120℃ |
| Punto di ebollizione | 337.9°C at 760 mmHg |
| Indice di rifrazione | 1.701 |
| Punto d'infiammabilità | 151.1°C |
| Pressione di vapore | 5.2E-05mmHg at 25°C |
| MSDS | |