ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
622-46-8 Phenyl carbamate |
|
Nama produk | Phenyl carbamate |
Nama bahasa Inggris | Phenyl carbamate;AI3-50866;CCRIS 5071;NSC 66509;Carbamic acid, phenyl ester |
MF | C7H7NO2 |
Berat Molekul | 137.136 |
InChI | InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
CAS NO | 622-46-8 |
EINECS | 210-737-1 |
Struktur Molekul | ![]() |
Kepadatan | 1.2g/cm3 |
Titik lebur | 145-152℃ |
Titik didih | 278.9°C at 760 mmHg |
Indeks bias | 1.551 |
Titik nyala | 159.3°C |
Tekanan uap | 0.00416mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |