ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
622-46-8 Phenyl carbamate |
|
| produktnavn | Phenyl carbamate |
| Engelsk navn | Phenyl carbamate;AI3-50866;CCRIS 5071;NSC 66509;Carbamic acid, phenyl ester |
| Molekylær Formel | C7H7NO2 |
| Molekylvekt | 137.136 |
| InChI | InChI=1/C7H7NO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| CAS-nummer | 622-46-8 |
| EINECS | 210-737-1 |
| Molecular Structure | ![]() |
| Tetthet | 1.2g/cm3 |
| Smeltepunkt | 145-152℃ |
| Kokepunkt | 278.9°C at 760 mmHg |
| Brytningsindeks | 1.551 |
| Flammepunktet | 159.3°C |
| Damptrykk | 0.00416mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |