ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68441-68-9 Asam decanoic, ester campuran dengan asam oktanoat dan pentaerythritol |
|
Nama produk | Asam decanoic, ester campuran dengan asam oktanoat dan pentaerythritol |
Sinonim | Pentaerythrityl tetracaprylate/caprate; Asam oktanoat, asam decanoic, pentaerythritol ester; Pentaerythritol asam kaprilat asam kaprat dicampur ester; Pentaerythritol, tetraester caprylate caprate; Rantai lurus jenuh (C8 dan C10) ester pentaerythritol asam lemak; 2,2-bis (hidroksimetil) propana-1,3-diol; asam decanoic; asam oktanoat; |
Nama bahasa Inggris | Decanoic acid, mixed esters with octanoic acid and pentaerythritol;Pentaerythrityl tetracaprylate/caprate;Octanoic acid, decanoic acid, pentaerythritol ester;Pentaerythritol caprylic acid capric acid mixed esters;Pentaerythritol, caprylate caprate tetraester;Saturated straight chain (C8 and C10) fatty acid pentaerythritol ester;2,2-bis(hydroxymethyl)propane-1,3-diol; decanoic acid; octanoic acid |
MF | C23H48O8 |
Berat Molekul | 452.6224 |
InChI | InChI=1/C10H20O2.C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;6-1-5(2-7,3-8)4-9/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);6-9H,1-4H2 |
CAS NO | 68441-68-9 |
EINECS | 270-472-2 |
Struktur Molekul | ![]() |
Titik didih | 269.6°C at 760 mmHg |
Titik nyala | 121.8°C |
Tekanan uap | 0.00355mmHg at 25°C |
MSDS |