ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68441-68-9 데칸산, 옥탄산 및 펜타에리스리톨과 혼합된 에스테르 |
|
상품명칭 | 데칸산, 옥탄산 및 펜타에리스리톨과 혼합된 에스테르 |
별명 | Pentaerythrityl tetracaprylate/caprate; 옥탄산, 데칸산, 펜타에리스리톨 에스테르; 펜타에리트리톨, 카프릴산, 카프릭산 혼합 에스테르; 펜타에리트리톨, 카프릴레이트 카프레이트 테트라에스테르; 포화 직쇄 (C8 및 C10) 지방산 펜타에리스리톨 에스테르; 2,2- 비스 (하이드 록시 메틸) 프로판 -1,3- 디올; 데칸산; 옥탄산; |
영문 이름 | Decanoic acid, mixed esters with octanoic acid and pentaerythritol;Pentaerythrityl tetracaprylate/caprate;Octanoic acid, decanoic acid, pentaerythritol ester;Pentaerythritol caprylic acid capric acid mixed esters;Pentaerythritol, caprylate caprate tetraester;Saturated straight chain (C8 and C10) fatty acid pentaerythritol ester;2,2-bis(hydroxymethyl)propane-1,3-diol; decanoic acid; octanoic acid |
분자식 | C23H48O8 |
분자량 | 452.6224 |
InChI | InChI=1/C10H20O2.C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;6-1-5(2-7,3-8)4-9/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);6-9H,1-4H2 |
cas번호 | 68441-68-9 |
EC번호 | 270-472-2 |
분자 구조 | ![]() |
비등점 | 269.6°C at 760 mmHg |
인화점 | 121.8°C |
증기압 | 0.00355mmHg at 25°C |
MSDS |