ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
715-33-3 Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
|
| Nama produk | Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
| Nama bahasa Inggris | Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate;3,5-Dibromo-2,4-dihydroxy-6-methylbenzoic acid methyl ester |
| MF | C9H8Br2O4 |
| Berat Molekul | 339.9654 |
| InChI | InChI=1/C9H8Br2O4/c1-3-4(9(14)15-2)7(12)6(11)8(13)5(3)10/h12-13H,1-2H3 |
| CAS NO | 715-33-3 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.967g/cm3 |
| Titik didih | 307.4°C at 760 mmHg |
| Indeks bias | 1.636 |
| Titik nyala | 139.7°C |
| Tekanan uap | 0.0004mmHg at 25°C |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |