ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
715-33-3 Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
|
| نام محصول | Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate |
| نام انگلیسی | Methyl 3,5-dibromo-2,4-dihydroxy-6-methylbenzoate;3,5-Dibromo-2,4-dihydroxy-6-methylbenzoic acid methyl ester |
| میدان مغناطیسی | C9H8Br2O4 |
| وزن مولکولی | 339.9654 |
| InChI | InChI=1/C9H8Br2O4/c1-3-4(9(14)15-2)7(12)6(11)8(13)5(3)10/h12-13H,1-2H3 |
| شماره سیایاس | 715-33-3 |
| ساختار مولکولی | ![]() |
| تراکم | 1.967g/cm3 |
| نقطه غلیان | 307.4°C at 760 mmHg |
| ضریب شکست | 1.636 |
| نقطه اشتعال | 139.7°C |
| فشار بخار | 0.0004mmHg at 25°C |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |