ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
716-53-0 9-chloroanthracene |
|
| Nama produk | 9-chloroanthracene |
| Nama bahasa Inggris | 9-chloroanthracene;Anthracene, 9-chloro-;9-Chloroanthracene;CCRIS 5547 |
| MF | C14H9Cl |
| Berat Molekul | 212.6743 |
| InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| CAS NO | 716-53-0 |
| EINECS | 211-937-1 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.253g/cm3 |
| Titik lebur | 103-103℃ |
| Titik didih | 370.1°C at 760 mmHg |
| Indeks bias | 1.717 |
| Titik nyala | 179.2°C |
| Tekanan uap | 2.42E-05mmHg at 25°C |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |