ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
716-53-0 9-chloroanthracene |
|
| Nome do produto | 9-chloroanthracene |
| Nome em inglês | 9-chloroanthracene;Anthracene, 9-chloro-;9-Chloroanthracene;CCRIS 5547 |
| Fórmula molecular | C14H9Cl |
| Peso Molecular | 212.6743 |
| InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
| CAS Registry Number | 716-53-0 |
| EINECS | 211-937-1 |
| Estrutura Molecular | ![]() |
| Densidade | 1.253g/cm3 |
| Ponto de fusão | 103-103℃ |
| Ponto de ebulição | 370.1°C at 760 mmHg |
| índice de refração | 1.717 |
| O ponto de inflamação | 179.2°C |
| Pressão de vapor | 2.42E-05mmHg at 25°C |
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |