ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
909407-14-3 2,4,6-tris(3,5-diphenylphenyl)-1,3,5,2,4,6-trioxatriborinane |
|
| Nama produk | 2,4,6-tris(3,5-diphenylphenyl)-1,3,5,2,4,6-trioxatriborinane |
| Sinonim | ; boroxin, 2,4,6-tri[1,1':3',1''-terphenyl]-5'-yl-; Tri-1,1':3',1''-terfenil-5'-ylboroxin |
| Nama bahasa Inggris | 2,4,6-tris(3,5-diphenylphenyl)-1,3,5,2,4,6-trioxatriborinane;boroxin, 2,4,6-tri[1,1':3',1''-terphenyl]-5'-yl-;Tri-1,1':3',1''-terphenyl-5'-ylboroxin |
| MF | C54H39B3O3 |
| Berat Molekul | 768.3187 |
| InChI | InChI=1/C54H39B3O3/c1-7-19-40(20-8-1)46-31-47(41-21-9-2-10-22-41)35-52(34-46)55-58-56(53-36-48(42-23-11-3-12-24-42)32-49(37-53)43-25-13-4-14-26-43)60-57(59-55)54-38-50(44-27-15-5-16-28-44)33-51(39-54)45-29-17-6-18-30-45/h1-39H |
| CAS NO | 909407-14-3 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.236g/cm3 |
| Indeks bias | 1.691 |
| MSDS | |