ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
909407-14-3 2،4،6-tris(3،5-diphenylphenyl)-1،3،5،2،4،6-trioxatriborinane |
|
| نام محصول | 2،4،6-tris(3،5-diphenylphenyl)-1،3،5،2،4،6-trioxatriborinane |
| مترادف | ; بوروکسین, 2,4,6-tri[1,1':3',1''-ترفنیل]-5'-YL-; Tri-1،1':3',1'-ترفنیل-5'-ایلبوروکسین |
| نام انگلیسی | 2,4,6-tris(3,5-diphenylphenyl)-1,3,5,2,4,6-trioxatriborinane;boroxin, 2,4,6-tri[1,1':3',1''-terphenyl]-5'-yl-;Tri-1,1':3',1''-terphenyl-5'-ylboroxin |
| میدان مغناطیسی | C54H39B3O3 |
| وزن مولکولی | 768.3187 |
| InChI | InChI=1/C54H39B3O3/c1-7-19-40(20-8-1)46-31-47(41-21-9-2-10-22-41)35-52(34-46)55-58-56(53-36-48(42-23-11-3-12-24-42)32-49(37-53)43-25-13-4-14-26-43)60-57(59-55)54-38-50(44-27-15-5-16-28-44)33-51(39-54)45-29-17-6-18-30-45/h1-39H |
| شماره سیایاس | 909407-14-3 |
| ساختار مولکولی | ![]() |
| تراکم | 1.236g/cm3 |
| ضریب شکست | 1.691 |
| MSDS | |