Chemindex > 26782-74-1
IL ▼
26782-74-1 (S)-2-chloro-3-methylbutyric acid |
|
| שם המוצר | (S)-2-chloro-3-methylbutyric acid |
| שם אנגלי | (S)-2-chloro-3-methylbutyric acid;(S)-(-)-2-Chloro-3-methylbutyric acid;S-2-chloro-3-methylbutyric acid;(2S)-2-chloro-3-methylbutanoic acid |
| מולקולרית פורמולה | C5H9ClO2 |
| משקל מולקולרי | 136.5768 |
| InChl | InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
| מספר CAS | 26782-74-1 |
| מבנה מולקולרי |  |
| צפיפות | 1.159g/cm3 |
| נקודת רתיחה | 210.3°C at 760 mmHg |
| משקל סגולי | 1.447 |
| נקודת הבזק | 81°C |
| לחץ אדים | 0.0768mmHg at 25°C |
| סיכונים קודי | R34##Causes burns.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 