ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26782-74-1 (S)-2-chloro-3-methylbutyric acid |
|
שם המוצר | (S)-2-chloro-3-methylbutyric acid |
שם אנגלי | (S)-2-chloro-3-methylbutyric acid;(S)-(-)-2-Chloro-3-methylbutyric acid;S-2-chloro-3-methylbutyric acid;(2S)-2-chloro-3-methylbutanoic acid |
מולקולרית פורמולה | C5H9ClO2 |
משקל מולקולרי | 136.5768 |
InChl | InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
מספר CAS | 26782-74-1 |
מבנה מולקולרי | ![]() |
צפיפות | 1.159g/cm3 |
נקודת רתיחה | 210.3°C at 760 mmHg |
משקל סגולי | 1.447 |
נקודת הבזק | 81°C |
לחץ אדים | 0.0768mmHg at 25°C |
סיכונים קודי | R34##Causes burns.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |