ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26782-74-1 (S)-2-chloro-3-methylbutyric acid |
|
उत्पाद का नाम | (S)-2-chloro-3-methylbutyric acid |
अंग्रेज | (S)-2-chloro-3-methylbutyric acid;(S)-(-)-2-Chloro-3-methylbutyric acid;S-2-chloro-3-methylbutyric acid;(2S)-2-chloro-3-methylbutanoic acid |
आणविक फार्मूला | C5H9ClO2 |
आण्विक वजन | 136.5768 |
InChI | InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
कैस रजिस्टी संख्या | 26782-74-1 |
आणविक संरचना | ![]() |
घनत्व | 1.159g/cm3 |
उबलने का समय | 210.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.447 |
फ्लैश प्वाइंट | 81°C |
वाष्प का दबाव | 0.0768mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |