ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4410-12-2 1-Benzylhomopiperazine |
|
שם המוצר | 1-Benzylhomopiperazine |
שם אנגלי | 1-Benzylhomopiperazine;1-Benzylhexahydro-1,4-diazepine;N-benzylhomopiperazine;1-benzyl-1,4-diazepane;1-Benzyl-1,4-diazacycloheptane;1-Benzyl-1,4-diazacycloheptanel |
מולקולרית פורמולה | C12H18N2 |
משקל מולקולרי | 190.2847 |
InChl | InChI=1/C12H18N2/c1-2-5-12(6-3-1)11-14-9-4-7-13-8-10-14/h1-3,5-6,13H,4,7-11H2 |
מספר CAS | 4410-12-2 |
מבנה מולקולרי | ![]() |
צפיפות | 1.003g/cm3 |
נקודת רתיחה | 286.5°C at 760 mmHg |
משקל סגולי | 1.536 |
נקודת הבזק | 116.2°C |
לחץ אדים | 0.00263mmHg at 25°C |
סיכונים קודי | R34##Causes burns.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |