ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4410-12-2 1-Benzylhomopiperazine |
|
उत्पाद का नाम | 1-Benzylhomopiperazine |
अंग्रेज | 1-Benzylhomopiperazine;1-Benzylhexahydro-1,4-diazepine;N-benzylhomopiperazine;1-benzyl-1,4-diazepane;1-Benzyl-1,4-diazacycloheptane;1-Benzyl-1,4-diazacycloheptanel |
आणविक फार्मूला | C12H18N2 |
आण्विक वजन | 190.2847 |
InChI | InChI=1/C12H18N2/c1-2-5-12(6-3-1)11-14-9-4-7-13-8-10-14/h1-3,5-6,13H,4,7-11H2 |
कैस रजिस्टी संख्या | 4410-12-2 |
आणविक संरचना | ![]() |
घनत्व | 1.003g/cm3 |
उबलने का समय | 286.5°C at 760 mmHg |
अपवर्तक सूचकांक | 1.536 |
फ्लैश प्वाइंट | 116.2°C |
वाष्प का दबाव | 0.00263mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |