ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
64601-15-6 חומצה דקנואית, תרכובת עם 2-(איזופרופילמינו)אתנול (1: 1) |
|
שם המוצר | חומצה דקנואית, תרכובת עם 2-(איזופרופילמינו)אתנול (1: 1) |
נרדפות | חומצה דקאנואית, compd.עם 2-((1-מתילאתיל)אמינו)אתנול (1:1); חומצה דקנואית איזופרופילמינואתנול מלח; איזופרופילמינואתנול קפרט; חומצה דקאנואית, תרכובת עם 2-(isopropylamino)אתנול (1: 1); חומצה דקנואית - 2-(פרופאן-2-ילאמינו)אתנול (1: 1); |
שם אנגלי | decanoic acid, compound with 2-(isopropylamino)ethanol (1:1);Decanoic acid, compd. with 2-((1-methylethyl)amino)ethanol (1:1);Decanoic acid isopropylaminoethanol salt;Isopropylaminoethanol caprate;Decanoic acid, compound with 2-(isopropylamino)ethanol (1:1);decanoic acid - 2-(propan-2-ylamino)ethanol (1:1) |
מולקולרית פורמולה | C15H33NO3 |
משקל מולקולרי | 275.4274 |
InChl | InChI=1/C10H20O2.C5H13NO/c1-2-3-4-5-6-7-8-9-10(11)12;1-5(2)6-3-4-7/h2-9H2,1H3,(H,11,12);5-7H,3-4H2,1-2H3 |
מספר CAS | 64601-15-6 |
EINECS | 264-960-4 |
מבנה מולקולרי | ![]() |
נקודת רתיחה | 269.6°C at 760 mmHg |
נקודת הבזק | 121.8°C |
לחץ אדים | 0.00355mmHg at 25°C |
MSDS |