ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
64601-15-6 डिकैनोइक एसिड, 2- (आइसोप्रोपाइलैमिनो) इथेनॉल (1: 1) के साथ यौगिक |
|
उत्पाद का नाम | डिकैनोइक एसिड, 2- (आइसोप्रोपाइलैमिनो) इथेनॉल (1: 1) के साथ यौगिक |
समानार्थी | Decanoic एसिड, compd.2- ((1-मिथाइलथिल) एमिनो) इथेनॉल (1: 1) के साथ; Decanoic एसिड isopropylaminoethanol नमक; Isopropyllaminoethanol caprate; Decanoic एसिड, 2- (isopropylamino) इथेनॉल के साथ यौगिक (1:1); डिकैनोइक एसिड - 2- (प्रोपेन-2-यलामिनो) इथेनॉल (1: 1); |
अंग्रेज | decanoic acid, compound with 2-(isopropylamino)ethanol (1:1);Decanoic acid, compd. with 2-((1-methylethyl)amino)ethanol (1:1);Decanoic acid isopropylaminoethanol salt;Isopropylaminoethanol caprate;Decanoic acid, compound with 2-(isopropylamino)ethanol (1:1);decanoic acid - 2-(propan-2-ylamino)ethanol (1:1) |
आणविक फार्मूला | C15H33NO3 |
आण्विक वजन | 275.4274 |
InChI | InChI=1/C10H20O2.C5H13NO/c1-2-3-4-5-6-7-8-9-10(11)12;1-5(2)6-3-4-7/h2-9H2,1H3,(H,11,12);5-7H,3-4H2,1-2H3 |
कैस रजिस्टी संख्या | 64601-15-6 |
EINECS | 264-960-4 |
आणविक संरचना | ![]() |
उबलने का समय | 269.6°C at 760 mmHg |
फ्लैश प्वाइंट | 121.8°C |
वाष्प का दबाव | 0.00355mmHg at 25°C |
MSDS |