Chemindex > 68155-77-1
IL ▼
68155-77-1 דיסודיום מימן פוספט, תרכובת עם triethylamine (1: 1) |
|
| שם המוצר | דיסודיום מימן פוספט, תרכובת עם triethylamine (1: 1) |
| נרדפות | חומצה זרחתית, מלח נתרן, compd.עם N,N-diethylethanamine (1: 2: 1); חומצה זרחתית, מלח דיסודיום triethanolamine; דיסודיום מימן פוספט, תרכובת עם triethylamine (1: 1); חומצה זרחתית, מלח דיסודיום, compd.עם N,N-diethylethanamine (1: 1); נתרן מימן פוספט - N,N-diethylethanamine (2: 1: 1); |
| שם אנגלי | disodium hydrogen phosphate, compound with triethylamine (1:1);Phosphoric acid, sodium salt, compd. with N,N-diethylethanamine (1:2:1);Phosphoric acid, triethanolamine disodium salt;Disodium hydrogen phosphate, compound with triethylamine (1:1);Phosphoric acid, disodium salt, compd. with N,N-diethylethanamine (1:1);sodium hydrogen phosphate - N,N-diethylethanamine (2:1:1) |
| מולקולרית פורמולה | C6H16NNa2O4P |
| משקל מולקולרי | 243.1488 |
| InChl | InChI=1/C6H15N.2Na.H3O4P/c1-4-7(5-2)6-3;;;1-5(2,3)4/h4-6H2,1-3H3;;;(H3,1,2,3,4)/q;2*+1;/p-2 |
| מספר CAS | 68155-77-1 |
| EINECS | 268-989-3 |
| מבנה מולקולרי |  |
| נקודת רתיחה | 90.5°C at 760 mmHg |
| לחץ אדים | 56.1mmHg at 25°C |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 68155-77-1 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 