ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68155-77-1 disodyum hidrojen fosfat, trietilamin (1:1) ile bileşik |
|
Ürün Adı | disodyum hidrojen fosfat, trietilamin (1:1) ile bileşik |
Eş anlamlı | Fosforik asit, sodyum tuzu, compd.N,N-dietiletanamin (1:2:1) ile; Fosforik asit, trietanolamin disodyum tuzu; Disodyum hidrojen fosfat, trietilamin (1:1) içeren bileşik; Fosforik asit, disodyum tuzu, compd.N, N-dietiletanamin (1: 1) ile; sodyum hidrojen fosfat - N, N-dietiletanamin (2: 1: 1); |
ingilizce adı | disodium hydrogen phosphate, compound with triethylamine (1:1);Phosphoric acid, sodium salt, compd. with N,N-diethylethanamine (1:2:1);Phosphoric acid, triethanolamine disodium salt;Disodium hydrogen phosphate, compound with triethylamine (1:1);Phosphoric acid, disodium salt, compd. with N,N-diethylethanamine (1:1);sodium hydrogen phosphate - N,N-diethylethanamine (2:1:1) |
Moleküler Formülü | C6H16NNa2O4P |
Molekül Ağırlığı | 243.1488 |
InChI | InChI=1/C6H15N.2Na.H3O4P/c1-4-7(5-2)6-3;;;1-5(2,3)4/h4-6H2,1-3H3;;;(H3,1,2,3,4)/q;2*+1;/p-2 |
CAS kayıt numarası | 68155-77-1 |
EINECS | 268-989-3 |
Moleküler Yapısı | ![]() |
Kaynama noktası | 90.5°C at 760 mmHg |
Buhar basıncı | 56.1mmHg at 25°C |
MSDS |