ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-26-2 ethyl 2-fluoropentanoate |
|
| שם המוצר | ethyl 2-fluoropentanoate |
| שם אנגלי | ethyl 2-fluoropentanoate; |
| מולקולרית פורמולה | C7H13FO2 |
| משקל מולקולרי | 148.1753 |
| InChl | InChI=1/C7H13FO2/c1-3-5-6(8)7(9)10-4-2/h6H,3-5H2,1-2H3 |
| מספר CAS | 816-26-2 |
| מבנה מולקולרי | ![]() |
| צפיפות | 0.966g/cm3 |
| נקודת רתיחה | 158.6°C at 760 mmHg |
| משקל סגולי | 1.39 |
| נקודת הבזק | 49°C |
| לחץ אדים | 2.6mmHg at 25°C |
| MSDS | |