ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-26-2 ethyl 2-fluoropentanoate |
|
| Nome del prodotto | ethyl 2-fluoropentanoate |
| Nome inglese | ethyl 2-fluoropentanoate; |
| Formula molecolare | C7H13FO2 |
| Peso Molecolare | 148.1753 |
| InChI | InChI=1/C7H13FO2/c1-3-5-6(8)7(9)10-4-2/h6H,3-5H2,1-2H3 |
| Numero CAS | 816-26-2 |
| Struttura molecolare | ![]() |
| Densità | 0.966g/cm3 |
| Punto di ebollizione | 158.6°C at 760 mmHg |
| Indice di rifrazione | 1.39 |
| Punto d'infiammabilità | 49°C |
| Pressione di vapore | 2.6mmHg at 25°C |
| MSDS | |